CAS Registry Number 17200-29-2
Name:
Benzoxazole, 5-?chloro-
5-Chlorobenzoxazole
NSC 24984

Chemical Formula: C7H4ClNO
Exact Mass: 153.00
Molecular Weight: 153.57
m/z: 153.00 (100.0%), 155.00 (32.4%), 154.00 (8.0%), 156.00 (2.4%)

InChI:InChI=1S/C7H4ClNO/c8-5-1-2-7-6(3-5)9-4-10-7/h1-4H

Specification

98%

1. (1) Ose, Shinsuke; JP 32009075 B 1957 CAPLUS
2. (2) Sam, Joseph; Journal of Pharmaceutical Sciences 1964, V53(5), P538-44 CAPLUS
3. (3) Arisawa, Mieko; Tetrahedron Letters 2011, V52(18), P2344-2347 CAPLUS
4. (5) Lee, Jung June; Tetrahedron 2009, V65(43), P8821-8831 CAPLUS
5. (6) Foa, M.; Bollettino Scientifico della Facolta di Chimica Industriale di Bologna 1965, V23(2-3), P89-98 CAPLUS
6. (7) Hashida, Yoji; Nippon Kagaku Kaishi 1981, (11), P1732-8 CAPLUS
7. (8) Mohammadpoor-Baltork, Iraj; Monatshefte fuer Chemie 2007, V138(7), P663-667 CAPLUS
8. (9) Mohammadpoor-Baltork, Iraj; Catalysis Communications 2007, V8(12), P1865-1870 CAPLUS
9. (10) Mohammadpoor-Baltork, I.; Journal of the Iranian Chemical Society 2008, V5(Suppl.), PS65-S70 CAPLUS
10. (11) Hojati, Seyedeh Fatemeh; Monatshefte fuer Chemie 2011, V142(1), P87-91 CAPLUS