CAS Registry Number 42890-76-6
Name:
1,?2,?4-?Butanetriol, (2S)?-
1,2,4-Butanetriol, (S)-
(2S)-1,2,4-Butanetriol
(-)-(S)-1,2,4-Butanetriol
(-)-1,2,4-Butanetriol
(2S)-Butane-1,2,4-triol

Chemical Formula: C4H10O3
Exact Mass: 106.06
Molecular Weight: 106.12
m/z: 106.06 (100.0%), 107.07 (4.6%)

InChI:InChI=1S/C4H10O3/c5-2-1-4(7)3-6/h4-7H,1-3H2/t4-/m0/s1

Specification

98%

1. (1) Hungerbuehler, Ernst; Helvetica Chimica Acta 1981, V64(5), P1467-87 CAPLUS
2. (3) Tandon, Vishnu K.; Journal of Organic Chemistry 1983, V48(16), P2767-9 CAPLUS
3. (4) Kocienski, Philip J.; Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999) 1987, (10), P2183-7 CAPLUS
4. (7) Miyazawa, Masahiro; Heterocycles 2010, V81(8), P1891-1902 CAPLUS
5. (10) Hanessian, Stephen; Canadian Journal of Chemistry 1984, V62(11), P2146-7 CAPLUS
6. (11) Yamashita, Hiroyuki; Chemistry Letters 1985, (3), P363-6 CAPLUS