CAS Registry Number 51079-10-8
Name:
1H-?Indole-?3-?acetic acid, α-?oxo-?, ethyl ester
Indole-3-glyoxylic acid, ethyl ester (6CI,7CI)
Ethyl 2-(1H-indol-3-yl)-2-oxoacetate
Ethyl 3-indolylglyoxylate
Ethyl indole-3-glyoxylate
NSC 402543

Chemical Formula: C12H11NO3
Exact Mass: 217.07
Molecular Weight: 217.22
m/z: 217.07 (100.0%), 218.08 (13.2%), 219.08 (1.4%)

InChI:InChI=1S/C12H11NO3/c1-2-16-12(15)11(14)9-7-13-10-6-4-3-5-8(9)10/h3-7,13H,2H2,1H3

Specification

98%

1. (4) Nogrady, Thomas; Canadian Journal of Chemistry 1964, V42(2), P485-6 CAPLUS
2. (5) Oddo, Bernardo; Gazzetta Chimica Italiana 1927, V57, P827-35 CAPLUS
3. (6) Majima, Riko; Berichte der Deutschen Chemischen Gesellschaft [Abteilung] B: Abhandlungen 1924, V57B, P1449-53 CAPLUS
4. (7) Oikawa, Yuji; Journal of Organic Chemistry 1977, V42(7), P1213-16 CAPLUS
5. (8) Rawal, Viresh H.; Tetrahedron Letters 1985, V26(50), P6141-2 CAPLUS
6. (9) GB 778823 1957 CAPLUS
7. (10) Speeter, Merrill E.; Journal of the American Chemical Society 1954, V76, P6208-10 CAPLUS